cathysuggs16 cathysuggs16

01-03-2017
Mathematics

contestada

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

Respuesta :

LammettHash LammettHash

01-03-2017

This follows from the half-angle identity for cosine.

[tex]\cos^2\theta=\dfrac{1+\cos2\theta}2[/tex]

Answer Link

Himanichawla Himanichawla

27-09-2019

Answer:

it's true, don't have a step by step explanation just did it on my test.

Step-by-step explanation:

Answer Link

Otras preguntas

A plastic box with objects has a mass of 4 kg and is on a shelf at a height of 2.4 m. What will it's potential gravitational energy?

what is the source of people in utopia

How to write a letter to mr.Eric thomas for inspiring me in formal format. *note this is a homework

Find the equation of the midline of the function y = 2 sin(1∕4x) – 3. A) y = –3 B) y = 3 C) y = 2 D) y = 1∕4

(4x - 3) × (x + 2)=0

How much power does it take to lift a box with a weight of 50N to put it on a shelf that is 10m high in 10 sec?

Which statement best describes why the rising action is longer than the falling action? Complications and conflicts unfold slowly. Many characters are introduce

A collection of 30 coins consists of dimes and nickels. The total value is $1. 95How many dimes are there?

Does a chemical reaction in dynamic equilibrium mean that the concentration of reactants and products is equal? Explain.

For the function, f(x) = -2x 2, find f(-3). 36 18 -18 -36